C30H30F3N3O2 — CID 66939989
N-[[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octane-8-carbonyl]phenyl]methyl]benzamide (PubChem CID 66939989) has the molecular formula C30H30F3N3O2 and a molecular weight of 521.58 g/mol. Its IUPAC name is N-[[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octane-8-carbonyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octane-8-carbonyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 66939989 |
| Molecular Formula | C30H30F3N3O2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | N-[[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octane-8-carbonyl]phenyl]methyl]benzamide |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)c1cccc(CNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H30F3N3O2/c31-25-16-27(33)26(32)14-21(25)15-28(34)22-12-23-9-10-24(13-22)36(23)30(38)20-8-4-5-18(11-20)17-35-29(37)19-6-2-1-3-7-19/h1-8,11,14,16,22-24,28H,9-10,12-13,15,17,34H2,(H,35,37)/t22?,23?,24?,28-/m1/s1 |
| InChIKey | KNEDXDHBXDNKGT-QMWAFAICSA-N |
| XLogP | 4.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|