C24H28F3N3O3S — CID 66939642
N-[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]benzenesulfonamide (PubChem CID 66939642) has the molecular formula C24H28F3N3O3S and a molecular weight of 495.57 g/mol. Its IUPAC name is N-[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]benzenesulfonamide.
| Compound Name | N-[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66939642 |
| Molecular Formula | C24H28F3N3O3S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]benzenesulfonamide |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)CCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28F3N3O3S/c25-20-14-22(27)21(26)12-15(20)13-23(28)16-10-17-6-7-18(11-16)30(17)24(31)8-9-29-34(32,33)19-4-2-1-3-5-19/h1-5,12,14,16-18,23,29H,6-11,13,28H2/t16?,17?,18?,23-/m1/s1 |
| InChIKey | IAONEZNQNDCJGC-DNWXHASSSA-N |
| XLogP | 3.11 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|