C28H32F3N3O7S — CID 66939641
N-[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]benzenesulfonamide;(Z)-but-2-enedioic acid (PubChem CID 66939641) has the molecular formula C28H32F3N3O7S and a molecular weight of 611.64 g/mol. Its IUPAC name is N-[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]benzenesulfonamide;(Z)-but-2-enedioic acid.
| Compound Name | N-[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]benzenesulfonamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 66939641 |
| Molecular Formula | C28H32F3N3O7S |
| Molecular Weight | 611.64 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | N-[3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]benzenesulfonamide;(Z)-but-2-enedioic acid |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)CCNS(=O)(=O)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H28F3N3O3S.C4H4O4/c25-20-14-22(27)21(26)12-15(20)13-23(28)16-10-17-6-7-18(11-16)30(17)24(31)8-9-29-34(32,33)19-4-2-1-3-5-19;5-3(6)1-2-4(7)8/h1-5,12,14,16-18,23,29H,6-11,13,28H2;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16?,17?,18?,23-;/m1./s1 |
| InChIKey | APYWVQSRODKKFY-OHZXUZNBSA-N |
| XLogP | 2.82 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|