C24H30F3N3O6 — CID 66940054
N-[3-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]acetamide;(Z)-but-2-enedioic acid (PubChem CID 66940054) has the molecular formula C24H30F3N3O6 and a molecular weight of 513.51 g/mol. Its IUPAC name is N-[3-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]acetamide;(Z)-but-2-enedioic acid.
| Compound Name | N-[3-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]acetamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 66940054 |
| Molecular Formula | C24H30F3N3O6 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | N-[3-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]acetamide;(Z)-but-2-enedioic acid |
| SMILES | CC(=O)NCCC(=O)N1[C@@H]2CC[C@H]1CC([C@H](N)Cc1cc(F)c(F)cc1F)C2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H26F3N3O2.C4H4O4/c1-11(27)25-5-4-20(28)26-14-2-3-15(26)7-13(6-14)19(24)9-12-8-17(22)18(23)10-16(12)21;5-3(6)1-2-4(7)8/h8,10,13-15,19H,2-7,9,24H2,1H3,(H,25,27);1-2H,(H,5,6)(H,7,8)/b;2-1-/t13?,14-,15+,19-;/m1./s1 |
| InChIKey | GTWVMJHDWNNLFJ-SVGORMGXSA-N |
| XLogP | 1.98 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|