C21H26F3N3O7S — CID 69061411
2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]acetamide;(Z)-but-2-enedioic acid (PubChem CID 69061411) has the molecular formula C21H26F3N3O7S and a molecular weight of 521.51 g/mol. Its IUPAC name is 2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]acetamide;(Z)-but-2-enedioic acid.
| Compound Name | 2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]acetamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 69061411 |
| Molecular Formula | C21H26F3N3O7S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2-[[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]sulfonyl]acetamide;(Z)-but-2-enedioic acid |
| SMILES | NC(=O)CS(=O)(=O)N1C2CCC1CC([C@H](N)Cc1cc(F)c(F)cc1F)C2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H22F3N3O3S.C4H4O4/c18-13-7-15(20)14(19)5-9(13)6-16(21)10-3-11-1-2-12(4-10)23(11)27(25,26)8-17(22)24;5-3(6)1-2-4(7)8/h5,7,10-12,16H,1-4,6,8,21H2,(H2,22,24);1-2H,(H,5,6)(H,7,8)/b;2-1-/t10?,11?,12?,16-;/m1./s1 |
| InChIKey | VZXKFSUTEUUMRY-KPPLWLOBSA-N |
| XLogP | 0.74 |
| TPSA | 181.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|