C30H32F3N3O — CID 66940064
N-[[3-[[(5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]methyl]phenyl]methyl]benzamide (PubChem CID 66940064) has the molecular formula C30H32F3N3O and a molecular weight of 507.60 g/mol. Its IUPAC name is N-[[3-[[(5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]methyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[[(5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]methyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 66940064 |
| Molecular Formula | C30H32F3N3O |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | N-[[3-[[(5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]methyl]phenyl]methyl]benzamide |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CC[C@H](C1)N2Cc1cccc(CNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C30H32F3N3O/c31-26-16-28(33)27(32)14-22(26)15-29(34)23-12-24-9-10-25(13-23)36(24)18-20-6-4-5-19(11-20)17-35-30(37)21-7-2-1-3-8-21/h1-8,11,14,16,23-25,29H,9-10,12-13,15,17-18,34H2,(H,35,37)/t23?,24-,25?,29-/m1/s1 |
| InChIKey | YFHJVDMBMIVQAK-DZJMVIODSA-N |
| XLogP | 5.35 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|