C31H33F4N3O5S — CID 87211658
N-[2-[(1R,5S)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-4-fluorobenzamide;4-methylbenzenesulfonic acid (PubChem CID 87211658) has the molecular formula C31H33F4N3O5S and a molecular weight of 635.68 g/mol. Its IUPAC name is N-[2-[(1R,5S)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-4-fluorobenzamide;4-methylbenzenesulfonic acid.
| Compound Name | N-[2-[(1R,5S)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-4-fluorobenzamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87211658 |
| Molecular Formula | C31H33F4N3O5S |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.21 |
| IUPAC Name | N-[2-[(1R,5S)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-4-fluorobenzamide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N[C@H](Cc1cc(F)c(F)cc1F)C1C[C@H]2CC[C@@H](C1)N2C(=O)CNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25F4N3O2.C7H8O3S/c25-16-3-1-13(2-4-16)24(33)30-12-23(32)31-17-5-6-18(31)8-15(7-17)22(29)10-14-9-20(27)21(28)11-19(14)26;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,9,11,15,17-18,22H,5-8,10,12,29H2,(H,30,33);2-5H,1H3,(H,8,9,10)/t15?,17-,18+,22-;/m1./s1 |
| InChIKey | UYISJROIYKHMTH-NEPUHWJTSA-N |
| XLogP | 4.55 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|