C32H36F3N3O7S2 — CID 87211746
3-[3-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]propanoylsulfonyl]benzamide;4-methylbenzenesulfonic acid (PubChem CID 87211746) has the molecular formula C32H36F3N3O7S2 and a molecular weight of 695.78 g/mol. Its IUPAC name is 3-[3-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]propanoylsulfonyl]benzamide;4-methylbenzenesulfonic acid.
| Compound Name | 3-[3-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]propanoylsulfonyl]benzamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87211746 |
| Molecular Formula | C32H36F3N3O7S2 |
| Molecular Weight | 695.78 g/mol |
| Exact Mass | 695.19 |
| IUPAC Name | 3-[3-[(1S,5R)-3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]propanoylsulfonyl]benzamide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(=O)c1cccc(S(=O)(=O)C(=O)CCN2[C@@H]3CC[C@H]2CC([C@H](N)Cc2cc(F)c(F)cc2F)C3)c1 |
| InChI | InChI=1S/C25H28F3N3O4S.C7H8O3S/c26-20-13-22(28)21(27)11-15(20)12-23(29)16-8-17-4-5-18(9-16)31(17)7-6-24(32)36(34,35)19-3-1-2-14(10-19)25(30)33;1-6-2-4-7(5-3-6)11(8,9)10/h1-3,10-11,13,16-18,23H,4-9,12,29H2,(H2,30,33);2-5H,1H3,(H,8,9,10)/t16?,17-,18+,23-;/m1./s1 |
| InChIKey | XSMZDUMHZNHMHZ-OZVCBHLDSA-N |
| XLogP | 3.95 |
| TPSA | 177.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.78 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|