C24H32F3N3O3 — CID 140542806
3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-N-(4-hydroxycyclohexyl)-3-oxopropanamide (PubChem CID 140542806) has the molecular formula C24H32F3N3O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is 3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-N-(4-hydroxycyclohexyl)-3-oxopropanamide.
| Compound Name | 3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-N-(4-hydroxycyclohexyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 140542806 |
| Molecular Formula | C24H32F3N3O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 3-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-N-(4-hydroxycyclohexyl)-3-oxopropanamide |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)CC(=O)NC1CCC(O)CC1 |
| InChI | InChI=1S/C24H32F3N3O3/c25-19-11-21(27)20(26)9-13(19)10-22(28)14-7-16-3-4-17(8-14)30(16)24(33)12-23(32)29-15-1-5-18(31)6-2-15/h9,11,14-18,22,31H,1-8,10,12,28H2,(H,29,32)/t14?,15?,16?,17?,18?,22-/m1/s1 |
| InChIKey | KBCSPEBXJMBNQY-XOZKQYLDSA-N |
| XLogP | 2.55 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|