C24H32F3N3O3 — CID 140542809
N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-2-(oxan-4-yl)acetamide (PubChem CID 140542809) has the molecular formula C24H32F3N3O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-2-(oxan-4-yl)acetamide.
| Compound Name | N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 140542809 |
| Molecular Formula | C24H32F3N3O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]-2-(oxan-4-yl)acetamide |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)CNC(=O)CC1CCOCC1 |
| InChI | InChI=1S/C24H32F3N3O3/c25-19-12-21(27)20(26)10-15(19)11-22(28)16-8-17-1-2-18(9-16)30(17)24(32)13-29-23(31)7-14-3-5-33-6-4-14/h10,12,14,16-18,22H,1-9,11,13,28H2,(H,29,31)/t16?,17?,18?,22-/m1/s1 |
| InChIKey | KZYRLWZCURVKMK-HEGUNSDMSA-N |
| XLogP | 2.68 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|