C25H31F3N2O3S — CID 173144955
tert-butyl-oxido-[[(1R)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)-2-(2,3,4-trifluorophenyl)ethyl]amino]sulfanium (PubChem CID 173144955) has the molecular formula C25H31F3N2O3S and a molecular weight of 496.60 g/mol. Its IUPAC name is tert-butyl-oxido-[[(1R)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)-2-(2,3,4-trifluorophenyl)ethyl]amino]sulfanium.
| Compound Name | tert-butyl-oxido-[[(1R)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)-2-(2,3,4-trifluorophenyl)ethyl]amino]sulfanium |
|---|---|
| PubChem CID | 173144955 |
| Molecular Formula | C25H31F3N2O3S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | tert-butyl-oxido-[[(1R)-1-(1-phenylmethoxycarbonylpiperidin-4-yl)-2-(2,3,4-trifluorophenyl)ethyl]amino]sulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@H](Cc1ccc(F)c(F)c1F)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H31F3N2O3S/c1-25(2,3)34(32)29-21(15-19-9-10-20(26)23(28)22(19)27)18-11-13-30(14-12-18)24(31)33-16-17-7-5-4-6-8-17/h4-10,18,21,29H,11-16H2,1-3H3/t21-,34?/m1/s1 |
| InChIKey | DRSCJJIPVBVFIZ-VZESWDRUSA-N |
| XLogP | 5.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|