C26H31F3N2O4 — CID 59009390
benzyl 4-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2,4,5-trifluorophenyl)ethyl]piperidine-1-carboxylate (PubChem CID 59009390) has the molecular formula C26H31F3N2O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is benzyl 4-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2,4,5-trifluorophenyl)ethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2,4,5-trifluorophenyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59009390 |
| Molecular Formula | C26H31F3N2O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | benzyl 4-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2,4,5-trifluorophenyl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1cc(F)c(F)cc1F)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H31F3N2O4/c1-26(2,3)35-24(32)30-23(14-19-13-21(28)22(29)15-20(19)27)18-9-11-31(12-10-18)25(33)34-16-17-7-5-4-6-8-17/h4-8,13,15,18,23H,9-12,14,16H2,1-3H3,(H,30,32)/t23-/m1/s1 |
| InChIKey | DRJLYRPLMHXLPW-HSZRJFAPSA-N |
| XLogP | 5.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|