C17H22F3NO3S — CID 163295595
benzyl (4S)-4-[[(S)-tert-butylsulfinyl]amino]-5,5,5-trifluoro-2-methylidenepentanoate (PubChem CID 163295595) has the molecular formula C17H22F3NO3S and a molecular weight of 377.43 g/mol. Its IUPAC name is benzyl (4S)-4-[[(S)-tert-butylsulfinyl]amino]-5,5,5-trifluoro-2-methylidenepentanoate.
| Compound Name | benzyl (4S)-4-[[(S)-tert-butylsulfinyl]amino]-5,5,5-trifluoro-2-methylidenepentanoate |
|---|---|
| PubChem CID | 163295595 |
| Molecular Formula | C17H22F3NO3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | benzyl (4S)-4-[[(S)-tert-butylsulfinyl]amino]-5,5,5-trifluoro-2-methylidenepentanoate |
| SMILES | C=C(C[C@H](N[S@@](=O)C(C)(C)C)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22F3NO3S/c1-12(15(22)24-11-13-8-6-5-7-9-13)10-14(17(18,19)20)21-25(23)16(2,3)4/h5-9,14,21H,1,10-11H2,2-4H3/t14-,25-/m0/s1 |
| InChIKey | LPQQXKKNSFXALD-SXBQZSJRSA-N |
| XLogP | 3.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|