(4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate

C18H20O3S — CID 15953553

IUPAC(4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate
SMILESCCC(Sc1ccccc1)C(=O)OCc1ccc(OC)cc1
InChIInChI=1S/C18H20O3S/c1-3-17(22-16-7-5-4-6-8-16)18(19)21-13-14-9-11-15(20-2)12-10-14/h4-12,17H,3,13H2,1-2H3
InChIKeyFCWQZJJAAIRNGB-UHFFFAOYSA-N
MW316.42 g/mol
LogP4.31
Rot. Bonds7

About (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate

(4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate (PubChem CID 15953553) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate.

Molecular Properties

Compound Name(4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate
PubChem CID15953553
Molecular FormulaC18H20O3S
Molecular Weight316.42 g/mol
Exact Mass316.11
IUPAC Name(4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate
SMILESCCC(Sc1ccccc1)C(=O)OCc1ccc(OC)cc1
InChIInChI=1S/C18H20O3S/c1-3-17(22-16-7-5-4-6-8-16)18(19)21-13-14-9-11-15(20-2)12-10-14/h4-12,17H,3,13H2,1-2H3
InChIKeyFCWQZJJAAIRNGB-UHFFFAOYSA-N
XLogP4.31
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.42
LogP ≤ 54.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate?
The IUPAC name of (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate (CID 15953553) is (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate.
What is the SMILES notation for (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate?
The canonical SMILES for (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate is CCC(Sc1ccccc1)C(=O)OCc1ccc(OC)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate?
The InChIKey is FCWQZJJAAIRNGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3S/c1-3-17(22-16-7-5-4-6-8-16)18(19)21-13-14-9-11-15(20-2)12-10-14/h4-12,17H,3,13H2,1-2H3.
What are the key properties of (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate?
(4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate has a molecular weight of 316.42 g/mol, XLogP of 4.31, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 2-phenylsulfanylbutanoate is sourced from PubChem (CID 15953553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).