C12H23NO2 — CID 62951544
ethyl 4,4-dimethyl-2-(prop-2-enylamino)pentanoate (PubChem CID 62951544) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is ethyl 4,4-dimethyl-2-(prop-2-enylamino)pentanoate.
| Compound Name | ethyl 4,4-dimethyl-2-(prop-2-enylamino)pentanoate |
|---|---|
| PubChem CID | 62951544 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | ethyl 4,4-dimethyl-2-(prop-2-enylamino)pentanoate |
| SMILES | C=CCNC(CC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C12H23NO2/c1-6-8-13-10(9-12(3,4)5)11(14)15-7-2/h6,10,13H,1,7-9H2,2-5H3 |
| InChIKey | LDEJRVOFANOMTM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|