C11H19F2NO2 — CID 135037835
ethyl 2,2-difluoro-4-methyl-3-(prop-2-enylamino)pentanoate (PubChem CID 135037835) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is ethyl 2,2-difluoro-4-methyl-3-(prop-2-enylamino)pentanoate.
| Compound Name | ethyl 2,2-difluoro-4-methyl-3-(prop-2-enylamino)pentanoate |
|---|---|
| PubChem CID | 135037835 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | ethyl 2,2-difluoro-4-methyl-3-(prop-2-enylamino)pentanoate |
| SMILES | C=CCNC(C(C)C)C(F)(F)C(=O)OCC |
| InChI | InChI=1S/C11H19F2NO2/c1-5-7-14-9(8(3)4)11(12,13)10(15)16-6-2/h5,8-9,14H,1,6-7H2,2-4H3 |
| InChIKey | KRZRDXOMGKVVGL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|