C9H17F2NO3 — CID 14503329
ethyl 4-amino-2,2-difluoro-3-hydroxy-5-methylhexanoate (PubChem CID 14503329) has the molecular formula C9H17F2NO3 and a molecular weight of 225.23 g/mol. Its IUPAC name is ethyl 4-amino-2,2-difluoro-3-hydroxy-5-methylhexanoate.
| Compound Name | ethyl 4-amino-2,2-difluoro-3-hydroxy-5-methylhexanoate |
|---|---|
| PubChem CID | 14503329 |
| Molecular Formula | C9H17F2NO3 |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | ethyl 4-amino-2,2-difluoro-3-hydroxy-5-methylhexanoate |
| SMILES | CCOC(=O)C(F)(F)C(O)C(N)C(C)C |
| InChI | InChI=1S/C9H17F2NO3/c1-4-15-8(14)9(10,11)7(13)6(12)5(2)3/h5-7,13H,4,12H2,1-3H3 |
| InChIKey | RALRYUVUHZVBBX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |