C7H12F2O5 — CID 143803967
ethyl (4R)-2,2-difluoro-3,4,5-trihydroxypentanoate (PubChem CID 143803967) has the molecular formula C7H12F2O5 and a molecular weight of 214.16 g/mol. Its IUPAC name is ethyl (4R)-2,2-difluoro-3,4,5-trihydroxypentanoate.
| Compound Name | ethyl (4R)-2,2-difluoro-3,4,5-trihydroxypentanoate |
|---|---|
| PubChem CID | 143803967 |
| Molecular Formula | C7H12F2O5 |
| Molecular Weight | 214.16 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | ethyl (4R)-2,2-difluoro-3,4,5-trihydroxypentanoate |
| SMILES | CCOC(=O)C(F)(F)C(O)[C@H](O)CO |
| InChI | InChI=1S/C7H12F2O5/c1-2-14-6(13)7(8,9)5(12)4(11)3-10/h4-5,10-12H,2-3H2,1H3/t4-,5?/m1/s1 |
| InChIKey | XPBCQKWRFQFBNN-CNZKWPKMSA-N |
| XLogP | -1.10 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.16 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |