C9H17F2NO3 — CID 86312455
ethyl (3S)-3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate (PubChem CID 86312455) has the molecular formula C9H17F2NO3 and a molecular weight of 225.23 g/mol. Its IUPAC name is ethyl (3S)-3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate.
| Compound Name | ethyl (3S)-3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 86312455 |
| Molecular Formula | C9H17F2NO3 |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | ethyl (3S)-3-(dimethylamino)-3-ethoxy-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](OCC)N(C)C |
| InChI | InChI=1S/C9H17F2NO3/c1-5-14-7(12(3)4)9(10,11)8(13)15-6-2/h7H,5-6H2,1-4H3/t7-/m0/s1 |
| InChIKey | WQKRWROIDBGNCS-ZETCQYMHSA-N |
| XLogP | 1.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|