C9H18O8 — CID 159843269
ethyl (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methoxyhexanoate (PubChem CID 159843269) has the molecular formula C9H18O8 and a molecular weight of 254.23 g/mol. Its IUPAC name is ethyl (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methoxyhexanoate.
| Compound Name | ethyl (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methoxyhexanoate |
|---|---|
| PubChem CID | 159843269 |
| Molecular Formula | C9H18O8 |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | ethyl (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2-methoxyhexanoate |
| SMILES | CCOC(=O)[C@@](O)(OC)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O8/c1-3-17-8(14)9(15,16-2)7(13)6(12)5(11)4-10/h5-7,10-13,15H,3-4H2,1-2H3/t5-,6-,7+,9+/m1/s1 |
| InChIKey | NOYPKUGQQHPIOP-JAKMQLQISA-N |
| XLogP | -3.04 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|