C6H13NO7 — CID 163211863
(2R,3R,4R,5R)-2-amino-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 163211863) has the molecular formula C6H13NO7 and a molecular weight of 211.17 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-amino-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | (2R,3R,4R,5R)-2-amino-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 163211863 |
| Molecular Formula | C6H13NO7 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (2R,3R,4R,5R)-2-amino-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | N[C@](O)(C(=O)O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO7/c7-6(14,5(12)13)4(11)3(10)2(9)1-8/h2-4,8-11,14H,1,7H2,(H,12,13)/t2-,3-,4-,6-/m1/s1 |
| InChIKey | SQXCNVUDTUUSNZ-ZGEUXELVSA-N |
| XLogP | -4.21 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|