C13H19NO6 — CID 149252911
(2R,3S,4R,5R)-2-benzyl-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 149252911) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-benzyl-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-2-benzyl-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 149252911 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2R,3S,4R,5R)-2-benzyl-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | NC(=O)[C@@](O)(Cc1ccccc1)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H19NO6/c14-12(19)13(20,6-8-4-2-1-3-5-8)11(18)10(17)9(16)7-15/h1-5,9-11,15-18,20H,6-7H2,(H2,14,19)/t9-,10-,11+,13-/m1/s1 |
| InChIKey | SIUBTMOEGXZZLQ-HNCHTBHHSA-N |
| XLogP | -2.48 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |