C13H15BrO7 — CID 54052070
(3S,4S,5R,6R)-3-bromo-3,4,5,6,7-pentahydroxy-1-phenylheptane-1,2-dione (PubChem CID 54052070) has the molecular formula C13H15BrO7 and a molecular weight of 363.16 g/mol. Its IUPAC name is (3S,4S,5R,6R)-3-bromo-3,4,5,6,7-pentahydroxy-1-phenylheptane-1,2-dione.
| Compound Name | (3S,4S,5R,6R)-3-bromo-3,4,5,6,7-pentahydroxy-1-phenylheptane-1,2-dione |
|---|---|
| PubChem CID | 54052070 |
| Molecular Formula | C13H15BrO7 |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | (3S,4S,5R,6R)-3-bromo-3,4,5,6,7-pentahydroxy-1-phenylheptane-1,2-dione |
| SMILES | O=C(C(=O)[C@@](O)(Br)[C@@H](O)[C@H](O)[C@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C13H15BrO7/c14-13(21,12(20)10(18)8(16)6-15)11(19)9(17)7-4-2-1-3-5-7/h1-5,8,10,12,15-16,18,20-21H,6H2/t8-,10-,12+,13+/m1/s1 |
| InChIKey | LTPAGMUJUBJDMH-JBYGLJPXSA-N |
| XLogP | -1.40 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|