C21H26O6 — CID 174554505
6-methoxy-5-methyl-7,7-diphenylhept-6-ene-1,2,3,4,5-pentol (PubChem CID 174554505) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 6-methoxy-5-methyl-7,7-diphenylhept-6-ene-1,2,3,4,5-pentol.
| Compound Name | 6-methoxy-5-methyl-7,7-diphenylhept-6-ene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174554505 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 6-methoxy-5-methyl-7,7-diphenylhept-6-ene-1,2,3,4,5-pentol |
| SMILES | COC(=C(c1ccccc1)c1ccccc1)C(C)(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C21H26O6/c1-21(26,19(25)18(24)16(23)13-22)20(27-2)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16,18-19,22-26H,13H2,1-2H3 |
| InChIKey | JXKMZRFNZAZWFM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|