C15H22O7 — CID 70140967
(2R,3R,4S,5R)-7-ethoxy-7-phenylhept-6-ene-1,2,3,4,5,6-hexol (PubChem CID 70140967) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is (2R,3R,4S,5R)-7-ethoxy-7-phenylhept-6-ene-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3R,4S,5R)-7-ethoxy-7-phenylhept-6-ene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 70140967 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2R,3R,4S,5R)-7-ethoxy-7-phenylhept-6-ene-1,2,3,4,5,6-hexol |
| SMILES | CCOC(=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C15H22O7/c1-2-22-15(9-6-4-3-5-7-9)14(21)13(20)12(19)11(18)10(17)8-16/h3-7,10-13,16-21H,2,8H2,1H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | SDUPGRXOHVIOEX-FVCCEPFGSA-N |
| XLogP | -0.61 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|