C25H32O10 — CID 174331561
benzoyl benzenecarboperoxoate;1,2,3,4,5-pentahydroxyundecan-6-one (PubChem CID 174331561) has the molecular formula C25H32O10 and a molecular weight of 492.52 g/mol. Its IUPAC name is benzoyl benzenecarboperoxoate;1,2,3,4,5-pentahydroxyundecan-6-one.
| Compound Name | benzoyl benzenecarboperoxoate;1,2,3,4,5-pentahydroxyundecan-6-one |
|---|---|
| PubChem CID | 174331561 |
| Molecular Formula | C25H32O10 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | benzoyl benzenecarboperoxoate;1,2,3,4,5-pentahydroxyundecan-6-one |
| SMILES | CCCCCC(=O)C(O)C(O)C(O)C(O)CO.O=C(OOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O4.C11H22O6/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-2-3-4-5-7(13)9(15)11(17)10(16)8(14)6-12/h1-10H;8-12,14-17H,2-6H2,1H3 |
| InChIKey | IXTIDQANZLPZIC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|