C11H12O3 — CID 125490903
3-hydroxy-3-methyl-1-phenylbutane-1,2-dione (PubChem CID 125490903) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-hydroxy-3-methyl-1-phenylbutane-1,2-dione.
| Compound Name | 3-hydroxy-3-methyl-1-phenylbutane-1,2-dione |
|---|---|
| PubChem CID | 125490903 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3-hydroxy-3-methyl-1-phenylbutane-1,2-dione |
| SMILES | CC(C)(O)C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O3/c1-11(2,14)10(13)9(12)8-6-4-3-5-7-8/h3-7,14H,1-2H3 |
| InChIKey | RPXYSXVJYGVIOW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|