C13H15ClO2 — CID 91703596
3-chloro-3-ethyl-1-phenylpentane-1,2-dione (PubChem CID 91703596) has the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. Its IUPAC name is 3-chloro-3-ethyl-1-phenylpentane-1,2-dione.
| Compound Name | 3-chloro-3-ethyl-1-phenylpentane-1,2-dione |
|---|---|
| PubChem CID | 91703596 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-chloro-3-ethyl-1-phenylpentane-1,2-dione |
| SMILES | CCC(Cl)(CC)C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15ClO2/c1-3-13(14,4-2)12(16)11(15)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | JNPYCFQXOXPITH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|