C21H23NO8 — CID 139904574
9H-fluoren-9-ylmethyl (2R,3S,4R,5R)-2-carbamoyl-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 139904574) has the molecular formula C21H23NO8 and a molecular weight of 417.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2R,3S,4R,5R)-2-carbamoyl-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (2R,3S,4R,5R)-2-carbamoyl-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 139904574 |
| Molecular Formula | C21H23NO8 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2R,3S,4R,5R)-2-carbamoyl-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | NC(=O)[C@@](O)(C(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C21H23NO8/c22-19(27)21(29,18(26)17(25)16(24)9-23)20(28)30-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-18,23-26,29H,9-10H2,(H2,22,27)/t16-,17-,18+,21-/m1/s1 |
| InChIKey | WHIWWOXKQICQFR-DCXXXQMHSA-N |
| XLogP | -1.37 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|