C21H23NO9 — CID 140635553
(2S,3S,4R,5R)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 140635553) has the molecular formula C21H23NO9 and a molecular weight of 433.41 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | (2S,3S,4R,5R)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 140635553 |
| Molecular Formula | C21H23NO9 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (2S,3S,4R,5R)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonyl)-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | N[C@@](O)(C(=O)O)[C@](O)(C(=O)OCC1c2ccccc2-c2ccccc21)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C21H23NO9/c22-21(30,18(26)27)20(29,17(25)16(24)9-23)19(28)31-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-17,23-25,29-30H,9-10,22H2,(H,26,27)/t16-,17-,20-,21-/m1/s1 |
| InChIKey | MGJZFMNHZVYIJH-DEPWHIHDSA-N |
| XLogP | -1.48 |
| TPSA | 190.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|