C25H32N2O8 — CID 11016417
9H-fluoren-9-ylmethyl N-[(2S)-1-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 11016417) has the molecular formula C25H32N2O8 and a molecular weight of 488.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11016417 |
| Molecular Formula | C25H32N2O8 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[methyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C25H32N2O8/c1-14(24(33)27(2)11-20(29)22(31)23(32)21(30)12-28)26-25(34)35-13-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,14,19-23,28-32H,11-13H2,1-2H3,(H,26,34)/t14-,20-,21+,22+,23+/m0/s1 |
| InChIKey | UGWOIJNKAXGRAH-AHILNLLBSA-N |
| XLogP | -0.19 |
| TPSA | 159.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |