C21H24N2O6 — CID 174556181
[(4-amino-3-benzyl-2,3-dihydroxy-4-oxobutanoyl)amino] 4-phenylbutanoate (PubChem CID 174556181) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is [(4-amino-3-benzyl-2,3-dihydroxy-4-oxobutanoyl)amino] 4-phenylbutanoate.
| Compound Name | [(4-amino-3-benzyl-2,3-dihydroxy-4-oxobutanoyl)amino] 4-phenylbutanoate |
|---|---|
| PubChem CID | 174556181 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [(4-amino-3-benzyl-2,3-dihydroxy-4-oxobutanoyl)amino] 4-phenylbutanoate |
| SMILES | NC(=O)C(O)(Cc1ccccc1)C(O)C(=O)NOC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C21H24N2O6/c22-20(27)21(28,14-16-10-5-2-6-11-16)18(25)19(26)23-29-17(24)13-7-12-15-8-3-1-4-9-15/h1-6,8-11,18,25,28H,7,12-14H2,(H2,22,27)(H,23,26) |
| InChIKey | RTYSXSFFSFLROF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|