C20H30O5 — CID 58280602
[(6R)-6,8-dihydroxy-7,7-dimethyl-5-oxooctyl] 4-phenylbutanoate (PubChem CID 58280602) has the molecular formula C20H30O5 and a molecular weight of 350.45 g/mol. Its IUPAC name is [(6R)-6,8-dihydroxy-7,7-dimethyl-5-oxooctyl] 4-phenylbutanoate.
| Compound Name | [(6R)-6,8-dihydroxy-7,7-dimethyl-5-oxooctyl] 4-phenylbutanoate |
|---|---|
| PubChem CID | 58280602 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [(6R)-6,8-dihydroxy-7,7-dimethyl-5-oxooctyl] 4-phenylbutanoate |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)CCCCOC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C20H30O5/c1-20(2,15-21)19(24)17(22)12-6-7-14-25-18(23)13-8-11-16-9-4-3-5-10-16/h3-5,9-10,19,21,24H,6-8,11-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | SFHTZZNFYYVITD-IBGZPJMESA-N |
| XLogP | 2.67 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|