C7H15NO7 — CID 150619072
(3R,4S,5R,6R)-2-amino-2,3,4,5,6,7-hexahydroxyheptanal (PubChem CID 150619072) has the molecular formula C7H15NO7 and a molecular weight of 225.20 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-amino-2,3,4,5,6,7-hexahydroxyheptanal.
| Compound Name | (3R,4S,5R,6R)-2-amino-2,3,4,5,6,7-hexahydroxyheptanal |
|---|---|
| PubChem CID | 150619072 |
| Molecular Formula | C7H15NO7 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (3R,4S,5R,6R)-2-amino-2,3,4,5,6,7-hexahydroxyheptanal |
| SMILES | NC(O)(C=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15NO7/c8-7(15,2-10)6(14)5(13)4(12)3(11)1-9/h2-6,9,11-15H,1,8H2/t3-,4-,5+,6-,7?/m1/s1 |
| InChIKey | IVMZFEDHPNMLGE-WLDMJGECSA-N |
| XLogP | -4.73 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|