C6H12O5S — CID 174770930
3,4,5,6-tetrahydroxy-2-sulfanylhexanal (PubChem CID 174770930) has the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-2-sulfanylhexanal.
| Compound Name | 3,4,5,6-tetrahydroxy-2-sulfanylhexanal |
|---|---|
| PubChem CID | 174770930 |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-2-sulfanylhexanal |
| SMILES | O=CC(S)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O5S/c7-1-3(9)5(10)6(11)4(12)2-8/h2-7,9-12H,1H2 |
| InChIKey | NXVOOAZKRKCYIV-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|