C7H16ClN3O6 — CID 141125342
2-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-2-yl]guanidine;hydrochloride (PubChem CID 141125342) has the molecular formula C7H16ClN3O6 and a molecular weight of 273.67 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-2-yl]guanidine;hydrochloride.
| Compound Name | 2-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-2-yl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 141125342 |
| Molecular Formula | C7H16ClN3O6 |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-1-oxohexan-2-yl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N[C@](O)(C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15N3O6.ClH/c8-6(9)10-7(16,2-12)5(15)4(14)3(13)1-11;/h2-5,11,13-16H,1H2,(H4,8,9,10);1H/t3-,4-,5+,7+;/m1./s1 |
| InChIKey | FYSJVHHVAUEDQK-KPPHEPBOSA-N |
| XLogP | -4.36 |
| TPSA | 182.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|