C8H16N2O6 — CID 146680965
N-[(2S,3R,4S)-2-amino-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide (PubChem CID 146680965) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is N-[(2S,3R,4S)-2-amino-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide.
| Compound Name | N-[(2S,3R,4S)-2-amino-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 146680965 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-[(2S,3R,4S)-2-amino-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@](N)(C=O)[C@@H](O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C8H16N2O6/c1-4(13)10-8(9,3-12)7(16)6(15)5(14)2-11/h3,5-7,11,14-16H,2,9H2,1H3,(H,10,13)/t5?,6-,7+,8-/m1/s1 |
| InChIKey | ZXRZMVIDSCMPQI-KTUCCBJNSA-N |
| XLogP | -3.95 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|