C8H16N2O6 — CID 87427473
(5R,6S,7R)-4,4-diamino-5,6,7,8-tetrahydroxyoctane-2,3-dione (PubChem CID 87427473) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is (5R,6S,7R)-4,4-diamino-5,6,7,8-tetrahydroxyoctane-2,3-dione.
| Compound Name | (5R,6S,7R)-4,4-diamino-5,6,7,8-tetrahydroxyoctane-2,3-dione |
|---|---|
| PubChem CID | 87427473 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (5R,6S,7R)-4,4-diamino-5,6,7,8-tetrahydroxyoctane-2,3-dione |
| SMILES | CC(=O)C(=O)C(N)(N)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16N2O6/c1-3(12)6(15)8(9,10)7(16)5(14)4(13)2-11/h4-5,7,11,13-14,16H,2,9-10H2,1H3/t4-,5-,7+/m1/s1 |
| InChIKey | BOEGXQDGFICLEO-XAHCXIQSSA-N |
| XLogP | -4.17 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|