C8H15NO7 — CID 141156432
(2S,3S,4S,5R)-2-(2-deuterioacetyl)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 141156432) has the molecular formula C8H15NO7 and a molecular weight of 238.21 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-(2-deuterioacetyl)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2S,3S,4S,5R)-2-(2-deuterioacetyl)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 141156432 |
| Molecular Formula | C8H15NO7 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2S,3S,4S,5R)-2-(2-deuterioacetyl)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | [2H]CC(=O)[C@](O)(C(N)=O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO7/c1-3(11)8(16,7(9)15)6(14)5(13)4(12)2-10/h4-6,10,12-14,16H,2H2,1H3,(H2,9,15)/t4-,5+,6+,8-/m1/s1/i1D |
| InChIKey | QLVMBIUKVFVVBX-BJGSTUAHSA-N |
| XLogP | -4.13 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|