C8H12Na2O10 — CID 22856675
disodium;2-hydroxy-2-[(1R,2R,3S,4R)-1,2,3,4,5-pentahydroxypentyl]propanedioate (PubChem CID 22856675) has the molecular formula C8H12Na2O10 and a molecular weight of 314.15 g/mol. Its IUPAC name is disodium;2-hydroxy-2-[(1R,2R,3S,4R)-1,2,3,4,5-pentahydroxypentyl]propanedioate.
| Compound Name | disodium;2-hydroxy-2-[(1R,2R,3S,4R)-1,2,3,4,5-pentahydroxypentyl]propanedioate |
|---|---|
| PubChem CID | 22856675 |
| Molecular Formula | C8H12Na2O10 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | disodium;2-hydroxy-2-[(1R,2R,3S,4R)-1,2,3,4,5-pentahydroxypentyl]propanedioate |
| SMILES | O=C([O-])C(O)(C(=O)[O-])[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO.[Na+].[Na+] |
| InChI | InChI=1S/C8H14O10.2Na/c9-1-2(10)3(11)4(12)5(13)8(18,6(14)15)7(16)17;;/h2-5,9-13,18H,1H2,(H,14,15)(H,16,17);;/q;2*+1/p-2/t2-,3+,4-,5-;;/m1../s1 |
| InChIKey | JCNMOLWMHPKYMK-YQYFPWPPSA-L |
| XLogP | -13.34 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | -13.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|