C8H13NO9 — CID 175771280
(4R,5S,6R,7R)-4,5,6,7,8-pentahydroxy-4-nitrooctane-2,3-dione (PubChem CID 175771280) has the molecular formula C8H13NO9 and a molecular weight of 267.19 g/mol. Its IUPAC name is (4R,5S,6R,7R)-4,5,6,7,8-pentahydroxy-4-nitrooctane-2,3-dione.
| Compound Name | (4R,5S,6R,7R)-4,5,6,7,8-pentahydroxy-4-nitrooctane-2,3-dione |
|---|---|
| PubChem CID | 175771280 |
| Molecular Formula | C8H13NO9 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | (4R,5S,6R,7R)-4,5,6,7,8-pentahydroxy-4-nitrooctane-2,3-dione |
| SMILES | CC(=O)C(=O)[C@](O)([C@@H](O)[C@H](O)[C@H](O)CO)[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO9/c1-3(11)6(14)8(16,9(17)18)7(15)5(13)4(12)2-10/h4-5,7,10,12-13,15-16H,2H2,1H3/t4-,5-,7+,8+/m1/s1 |
| InChIKey | MJHNWOPPRNAUBS-KYNKHSRBSA-N |
| XLogP | -3.82 |
| TPSA | 178.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|