C3H9NO5Pb — CID 174607017
λ2-plumbane;1-nitropropane-1,2,3-triol (PubChem CID 174607017) has the molecular formula C3H9NO5Pb and a molecular weight of 346.31 g/mol. Its IUPAC name is λ2-plumbane;1-nitropropane-1,2,3-triol.
| Compound Name | λ2-plumbane;1-nitropropane-1,2,3-triol |
|---|---|
| PubChem CID | 174607017 |
| Molecular Formula | C3H9NO5Pb |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | λ2-plumbane;1-nitropropane-1,2,3-triol |
| SMILES | O=[N+]([O-])C(O)C(O)CO.[PbH2] |
| InChI | InChI=1S/C3H7NO5.Pb.2H/c5-1-2(6)3(7)4(8)9;;;/h2-3,5-7H,1H2;;; |
| InChIKey | FCFRJCDQZSGMHF-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|