C6H13NO6 — CID 135374199
(2S)-2-amino-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 135374199) has the molecular formula C6H13NO6 and a molecular weight of 195.17 g/mol. Its IUPAC name is (2S)-2-amino-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (2S)-2-amino-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 135374199 |
| Molecular Formula | C6H13NO6 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2S)-2-amino-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | N[C@@](O)(C=O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H13NO6/c7-6(13,2-9)5(12)4(11)3(10)1-8/h2-5,8,10-13H,1,7H2/t3?,4?,5?,6-/m1/s1 |
| InChIKey | LOMHJEGAUNMOOE-LTQQEKPISA-N |
| XLogP | -4.09 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|