C8H14O8 — CID 172715343
(3R,4S,5R,6R)-3-formyl-3,4,5,6,7-pentahydroxyheptanoic acid (PubChem CID 172715343) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3-formyl-3,4,5,6,7-pentahydroxyheptanoic acid.
| Compound Name | (3R,4S,5R,6R)-3-formyl-3,4,5,6,7-pentahydroxyheptanoic acid |
|---|---|
| PubChem CID | 172715343 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (3R,4S,5R,6R)-3-formyl-3,4,5,6,7-pentahydroxyheptanoic acid |
| SMILES | O=C[C@@](O)(CC(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H14O8/c9-2-4(11)6(14)7(15)8(16,3-10)1-5(12)13/h3-4,6-7,9,11,14-16H,1-2H2,(H,12,13)/t4-,6-,7+,8+/m1/s1 |
| InChIKey | FUEIIGDCEYZDQU-GVYWOMJSSA-N |
| XLogP | -3.53 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|