C14H25NO12 — CID 21018811
(3S,4S,5S,6R)-3-formyl-3,4,5,6,7-pentahydroxy-N-[(3R,4R,5R)-3,4,5,6-tetrahydroxyhexanoyl]heptanamide (PubChem CID 21018811) has the molecular formula C14H25NO12 and a molecular weight of 399.35 g/mol. Its IUPAC name is (3S,4S,5S,6R)-3-formyl-3,4,5,6,7-pentahydroxy-N-[(3R,4R,5R)-3,4,5,6-tetrahydroxyhexanoyl]heptanamide.
| Compound Name | (3S,4S,5S,6R)-3-formyl-3,4,5,6,7-pentahydroxy-N-[(3R,4R,5R)-3,4,5,6-tetrahydroxyhexanoyl]heptanamide |
|---|---|
| PubChem CID | 21018811 |
| Molecular Formula | C14H25NO12 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (3S,4S,5S,6R)-3-formyl-3,4,5,6,7-pentahydroxy-N-[(3R,4R,5R)-3,4,5,6-tetrahydroxyhexanoyl]heptanamide |
| SMILES | O=C[C@](O)(CC(=O)NC(=O)C[C@@H](O)[C@@H](O)[C@H](O)CO)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H25NO12/c16-3-7(20)11(24)6(19)1-9(22)15-10(23)2-14(27,5-18)13(26)12(25)8(21)4-17/h5-8,11-13,16-17,19-21,24-27H,1-4H2,(H,15,22,23)/t6-,7-,8-,11-,12+,13+,14-/m1/s1 |
| InChIKey | HQTSTKSPKHCDKL-PHKHUKGBSA-N |
| XLogP | -6.51 |
| TPSA | 245.31 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | -6.51 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|