C14H19NO6 — CID 91275986
(3R,4S,5R)-3,4,5,6-tetrahydroxy-N-(2-phenylacetyl)hexanamide (PubChem CID 91275986) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3R,4S,5R)-3,4,5,6-tetrahydroxy-N-(2-phenylacetyl)hexanamide.
| Compound Name | (3R,4S,5R)-3,4,5,6-tetrahydroxy-N-(2-phenylacetyl)hexanamide |
|---|---|
| PubChem CID | 91275986 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3R,4S,5R)-3,4,5,6-tetrahydroxy-N-(2-phenylacetyl)hexanamide |
| SMILES | O=C(Cc1ccccc1)NC(=O)C[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H19NO6/c16-8-11(18)14(21)10(17)7-13(20)15-12(19)6-9-4-2-1-3-5-9/h1-5,10-11,14,16-18,21H,6-8H2,(H,15,19,20)/t10-,11-,14+/m1/s1 |
| InChIKey | WZYCGQJUAZNZPW-GYSYKLTISA-N |
| XLogP | -1.66 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |