C8H13F2NO6 — CID 175737189
(3R,4R,5R)-N-(2,2-difluoroacetyl)-3,4,5,6-tetrahydroxyhexanamide (PubChem CID 175737189) has the molecular formula C8H13F2NO6 and a molecular weight of 257.19 g/mol. Its IUPAC name is (3R,4R,5R)-N-(2,2-difluoroacetyl)-3,4,5,6-tetrahydroxyhexanamide.
| Compound Name | (3R,4R,5R)-N-(2,2-difluoroacetyl)-3,4,5,6-tetrahydroxyhexanamide |
|---|---|
| PubChem CID | 175737189 |
| Molecular Formula | C8H13F2NO6 |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (3R,4R,5R)-N-(2,2-difluoroacetyl)-3,4,5,6-tetrahydroxyhexanamide |
| SMILES | O=C(C[C@@H](O)[C@@H](O)[C@H](O)CO)NC(=O)C(F)F |
| InChI | InChI=1S/C8H13F2NO6/c9-7(10)8(17)11-5(15)1-3(13)6(16)4(14)2-12/h3-4,6-7,12-14,16H,1-2H2,(H,11,15,17)/t3-,4-,6-/m1/s1 |
| InChIKey | SXNQJMNPFHJMPI-ZMIZWQJLSA-N |
| XLogP | -2.64 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |