C9H18O7 — CID 163728512
(5S,6R,7R)-4,5,6,7,8,9-hexahydroxynonan-2-one (PubChem CID 163728512) has the molecular formula C9H18O7 and a molecular weight of 238.24 g/mol. Its IUPAC name is (5S,6R,7R)-4,5,6,7,8,9-hexahydroxynonan-2-one.
| Compound Name | (5S,6R,7R)-4,5,6,7,8,9-hexahydroxynonan-2-one |
|---|---|
| PubChem CID | 163728512 |
| Molecular Formula | C9H18O7 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (5S,6R,7R)-4,5,6,7,8,9-hexahydroxynonan-2-one |
| SMILES | CC(=O)CC(O)[C@H](O)[C@@H](O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C9H18O7/c1-4(11)2-5(12)7(14)9(16)8(15)6(13)3-10/h5-10,12-16H,2-3H2,1H3/t5?,6?,7-,8+,9+/m0/s1 |
| InChIKey | PQTBGYSOIQANNL-HPTJDRHVSA-N |
| XLogP | -3.24 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |