C9H16O6 — CID 87695330
(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-2-(2-oxopropyl)hexanal (PubChem CID 87695330) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-2-(2-oxopropyl)hexanal.
| Compound Name | (2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-2-(2-oxopropyl)hexanal |
|---|---|
| PubChem CID | 87695330 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-2-(2-oxopropyl)hexanal |
| SMILES | CC(=O)C[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H16O6/c1-5(12)2-6(3-10)8(14)9(15)7(13)4-11/h3,6-9,11,13-15H,2,4H2,1H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | WBYCCZJHAFMWKO-KDXUFGMBSA-N |
| XLogP | -2.14 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|