C12H20NO8+ — CID 22789786
triacetyl-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]azanium (PubChem CID 22789786) has the molecular formula C12H20NO8+ and a molecular weight of 306.29 g/mol. Its IUPAC name is triacetyl-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]azanium.
| Compound Name | triacetyl-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]azanium |
|---|---|
| PubChem CID | 22789786 |
| Molecular Formula | C12H20NO8+ |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | triacetyl-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]azanium |
| SMILES | CC(=O)[N+](C(C)=O)(C(C)=O)[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H20NO8/c1-6(16)13(7(2)17,8(3)18)9(4-14)11(20)12(21)10(19)5-15/h4,9-12,15,19-21H,5H2,1-3H3/q+1/t9-,10+,11+,12+/m0/s1 |
| InChIKey | YHOQNOFGPGXLIL-IRCOFANPSA-N |
| XLogP | -2.91 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|